C21H29N5O4 — CID 167111676
tert-butyl N-[(3R,6R)-4-azido-6-[(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]carbamate (PubChem CID 167111676) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl N-[(3R,6R)-4-azido-6-[(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,6R)-4-azido-6-[(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 167111676 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | tert-butyl N-[(3R,6R)-4-azido-6-[(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]carbamate |
| SMILES | C[C@H]1c2ccccc2CCN1C(=O)[C@H]1CC(N=[N+]=[N-])[C@@H](NC(=O)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C21H29N5O4/c1-13-15-8-6-5-7-14(15)9-10-26(13)19(27)18-11-16(24-25-22)17(12-29-18)23-20(28)30-21(2,3)4/h5-8,13,16-18H,9-12H2,1-4H3,(H,23,28)/t13-,16?,17-,18+/m0/s1 |
| InChIKey | PAAHJUKODXTXSA-DXJOGWAWSA-N |
| XLogP | 3.49 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|