C41H52N2O12S2 — CID 167115659
(4S)-4-[[4-[2-[(4-methylphenyl)sulfanylmethyl]-3-(4-methylphenyl)sulfonylpropanoyl]benzoyl]amino]-5-oxo-5-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylamino)pentanoic acid (PubChem CID 167115659) has the molecular formula C41H52N2O12S2 and a molecular weight of 829.00 g/mol. Its IUPAC name is (4S)-4-[[4-[2-[(4-methylphenyl)sulfanylmethyl]-3-(4-methylphenyl)sulfonylpropanoyl]benzoyl]amino]-5-oxo-5-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylamino)pentanoic acid.
| Compound Name | (4S)-4-[[4-[2-[(4-methylphenyl)sulfanylmethyl]-3-(4-methylphenyl)sulfonylpropanoyl]benzoyl]amino]-5-oxo-5-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylamino)pentanoic acid |
|---|---|
| PubChem CID | 167115659 |
| Molecular Formula | C41H52N2O12S2 |
| Molecular Weight | 829.00 g/mol |
| Exact Mass | 828.30 |
| IUPAC Name | (4S)-4-[[4-[2-[(4-methylphenyl)sulfanylmethyl]-3-(4-methylphenyl)sulfonylpropanoyl]benzoyl]amino]-5-oxo-5-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylamino)pentanoic acid |
| SMILES | Cc1ccc(SCC(CS(=O)(=O)c2ccc(C)cc2)C(=O)c2ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)NCC3COCCOCCOCCOCCO3)cc2)cc1 |
| InChI | InChI=1S/C41H52N2O12S2/c1-29-3-11-35(12-4-29)56-27-33(28-57(49,50)36-13-5-30(2)6-14-36)39(46)31-7-9-32(10-8-31)40(47)43-37(15-16-38(44)45)41(48)42-25-34-26-54-22-21-52-18-17-51-19-20-53-23-24-55-34/h3-14,33-34,37H,15-28H2,1-2H3,(H,42,48)(H,43,47)(H,44,45)/t33?,34?,37-/m0/s1 |
| InChIKey | WSPFBAOCJLUJGY-VGIRDQTJSA-N |
| XLogP | 3.91 |
| TPSA | 192.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |