C29H38N8O2S2 — CID 167122187
N-[(3R)-1-[[3-[[1-(7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)piperidin-4-yl]amino]sulfanylphenyl]methyl]piperidin-3-yl]prop-2-enamide (PubChem CID 167122187) has the molecular formula C29H38N8O2S2 and a molecular weight of 594.81 g/mol. Its IUPAC name is N-[(3R)-1-[[3-[[1-(7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)piperidin-4-yl]amino]sulfanylphenyl]methyl]piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R)-1-[[3-[[1-(7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)piperidin-4-yl]amino]sulfanylphenyl]methyl]piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167122187 |
| Molecular Formula | C29H38N8O2S2 |
| Molecular Weight | 594.81 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | N-[(3R)-1-[[3-[[1-(7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)piperidin-4-yl]amino]sulfanylphenyl]methyl]piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCCN(Cc2cccc(SNC3CCN(c4nc5c(N6CCOCC6)ncnc5s4)CC3)c2)C1 |
| InChI | InChI=1S/C29H38N8O2S2/c1-2-25(38)32-23-6-4-10-35(19-23)18-21-5-3-7-24(17-21)41-34-22-8-11-37(12-9-22)29-33-26-27(30-20-31-28(26)40-29)36-13-15-39-16-14-36/h2-3,5,7,17,20,22-23,34H,1,4,6,8-16,18-19H2,(H,32,38)/t23-/m1/s1 |
| InChIKey | DHKMKHBUUYQPCI-HSZRJFAPSA-N |
| XLogP | 3.46 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|