C9H17N3O — CID 167130251
(E)-N-methyl-N'-(methylideneamino)-N'-(oxan-2-yl)ethene-1,2-diamine (PubChem CID 167130251) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (E)-N-methyl-N'-(methylideneamino)-N'-(oxan-2-yl)ethene-1,2-diamine.
| Compound Name | (E)-N-methyl-N'-(methylideneamino)-N'-(oxan-2-yl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 167130251 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (E)-N-methyl-N'-(methylideneamino)-N'-(oxan-2-yl)ethene-1,2-diamine |
| SMILES | C=NN(/C=C/NC)C1CCCCO1 |
| InChI | InChI=1S/C9H17N3O/c1-10-6-7-12(11-2)9-5-3-4-8-13-9/h6-7,9-10H,2-5,8H2,1H3/b7-6+ |
| InChIKey | ZQUYNTQRENBRKP-VOTSOKGWSA-N |
| XLogP | 1.12 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|