C7H15NO — CID 92983084
(2R)-N,N-dimethyloxan-2-amine (PubChem CID 92983084) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (2R)-N,N-dimethyloxan-2-amine.
| Compound Name | (2R)-N,N-dimethyloxan-2-amine |
|---|---|
| PubChem CID | 92983084 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2R)-N,N-dimethyloxan-2-amine |
| SMILES | CN(C)[C@H]1CCCCO1 |
| InChI | InChI=1S/C7H15NO/c1-8(2)7-5-3-4-6-9-7/h7H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | JMVPFKZRJBWAEK-SSDOTTSWSA-N |
| XLogP | 1.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |