C7H17ClN2O — CID 156905355
2-N,2-N-dimethyloxane-2,4-diamine;hydrochloride (PubChem CID 156905355) has the molecular formula C7H17ClN2O and a molecular weight of 180.68 g/mol. Its IUPAC name is 2-N,2-N-dimethyloxane-2,4-diamine;hydrochloride.
| Compound Name | 2-N,2-N-dimethyloxane-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 156905355 |
| Molecular Formula | C7H17ClN2O |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-N,2-N-dimethyloxane-2,4-diamine;hydrochloride |
| SMILES | CN(C)C1CC(N)CCO1.Cl |
| InChI | InChI=1S/C7H16N2O.ClH/c1-9(2)7-5-6(8)3-4-10-7;/h6-7H,3-5,8H2,1-2H3;1H |
| InChIKey | HMCWZUMQTYTCHF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |