C6H10F3NO — CID 82652984
(2S,4S)-2-(trifluoromethyl)oxan-4-amine (PubChem CID 82652984) has the molecular formula C6H10F3NO and a molecular weight of 169.15 g/mol. Its IUPAC name is (2S,4S)-2-(trifluoromethyl)oxan-4-amine.
| Compound Name | (2S,4S)-2-(trifluoromethyl)oxan-4-amine |
|---|---|
| PubChem CID | 82652984 |
| Molecular Formula | C6H10F3NO |
| Molecular Weight | 169.15 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (2S,4S)-2-(trifluoromethyl)oxan-4-amine |
| SMILES | N[C@H]1CCO[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C6H10F3NO/c7-6(8,9)5-3-4(10)1-2-11-5/h4-5H,1-3,10H2/t4-,5-/m0/s1 |
| InChIKey | XGTXXWPCMBJBCB-WHFBIAKZSA-N |
| XLogP | 1.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.15 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |