C19H34N2O — CID 165127677
ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine (PubChem CID 165127677) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine.
| Compound Name | ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 165127677 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine |
| SMILES | C=C(C)c1cc(N)ccc1N(C)C1CCCCO1.CC.CC |
| InChI | InChI=1S/C15H22N2O.2C2H6/c1-11(2)13-10-12(16)7-8-14(13)17(3)15-6-4-5-9-18-15;2*1-2/h7-8,10,15H,1,4-6,9,16H2,2-3H3;2*1-2H3 |
| InChIKey | SXXJOYOMEIDFIG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|