About ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine
ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine (PubChem CID 165127677) has the molecular formula C19H34N2O
and a molecular weight of 306.49 g/mol. Its IUPAC name is ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine |
| PubChem CID | 165127677 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine |
| SMILES | C=C(C)c1cc(N)ccc1N(C)C1CCCCO1.CC.CC |
| InChI | InChI=1S/C15H22N2O.2C2H6/c1-11(2)13-10-12(16)7-8-14(13)17(3)15-6-4-5-9-18-15;2*1-2/h7-8,10,15H,1,4-6,9,16H2,2-3H3;2*1-2H3 |
| InChIKey | SXXJOYOMEIDFIG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine?
The IUPAC name of ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine (CID 165127677) is ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine.
What is the SMILES notation for ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine?
The canonical SMILES for ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine is C=C(C)c1cc(N)ccc1N(C)C1CCCCO1.CC.CC.
What is the InChIKey of ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine?
The InChIKey is SXXJOYOMEIDFIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O.2C2H6/c1-11(2)13-10-12(16)7-8-14(13)17(3)15-6-4-5-9-18-15;2*1-2/h7-8,10,15H,1,4-6,9,16H2,2-3H3;2*1-2H3.
What are the key properties of ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine?
ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine has a molecular weight of 306.49 g/mol, XLogP of 5.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-N-methyl-1-N-(oxan-2-yl)-2-prop-1-en-2-ylbenzene-1,4-diamine is sourced from PubChem (CID 165127677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).