C12H17IN4O — CID 89307336
4-N-ethenyl-6-iodo-2-methyl-4-N-(oxan-2-yl)pyrimidine-4,5-diamine (PubChem CID 89307336) has the molecular formula C12H17IN4O and a molecular weight of 360.20 g/mol. Its IUPAC name is 4-N-ethenyl-6-iodo-2-methyl-4-N-(oxan-2-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-ethenyl-6-iodo-2-methyl-4-N-(oxan-2-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 89307336 |
| Molecular Formula | C12H17IN4O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 4-N-ethenyl-6-iodo-2-methyl-4-N-(oxan-2-yl)pyrimidine-4,5-diamine |
| SMILES | C=CN(c1nc(C)nc(I)c1N)C1CCCCO1 |
| InChI | InChI=1S/C12H17IN4O/c1-3-17(9-6-4-5-7-18-9)12-10(14)11(13)15-8(2)16-12/h3,9H,1,4-7,14H2,2H3 |
| InChIKey | XAUCZPKXJOXERM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|