C19H14F2N4O2 — CID 167131399
2-[3-fluoro-2-[(2-fluorophenyl)methylamino]benzenecarboximidoyl]pyrimidine-5-carboxylic acid (PubChem CID 167131399) has the molecular formula C19H14F2N4O2 and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-[3-fluoro-2-[(2-fluorophenyl)methylamino]benzenecarboximidoyl]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[3-fluoro-2-[(2-fluorophenyl)methylamino]benzenecarboximidoyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 167131399 |
| Molecular Formula | C19H14F2N4O2 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-[3-fluoro-2-[(2-fluorophenyl)methylamino]benzenecarboximidoyl]pyrimidine-5-carboxylic acid |
| SMILES | [H]/N=C(\c1ncc(C(=O)O)cn1)c1cccc(F)c1NCc1ccccc1F |
| InChI | InChI=1S/C19H14F2N4O2/c20-14-6-2-1-4-11(14)8-23-17-13(5-3-7-15(17)21)16(22)18-24-9-12(10-25-18)19(26)27/h1-7,9-10,22-23H,8H2,(H,26,27)/b22-16- |
| InChIKey | YIEIRJDGFMVTSZ-JWGURIENSA-N |
| XLogP | 3.48 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|