C16H12F4N6 — CID 137317208
N-[(2-fluorophenyl)methyl]-3-[5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboximidoyl]pyridin-2-amine (PubChem CID 137317208) has the molecular formula C16H12F4N6 and a molecular weight of 364.31 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3-[5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboximidoyl]pyridin-2-amine.
| Compound Name | N-[(2-fluorophenyl)methyl]-3-[5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboximidoyl]pyridin-2-amine |
|---|---|
| PubChem CID | 137317208 |
| Molecular Formula | C16H12F4N6 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3-[5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboximidoyl]pyridin-2-amine |
| SMILES | [H]/N=C(\c1n[nH]c(C(F)(F)F)n1)c1cccnc1NCc1ccccc1F |
| InChI | InChI=1S/C16H12F4N6/c17-11-6-2-1-4-9(11)8-23-13-10(5-3-7-22-13)12(21)14-24-15(26-25-14)16(18,19)20/h1-7,21H,8H2,(H,22,23)(H,24,25,26)/b21-12- |
| InChIKey | PBOUUIBKEIDAIO-MTJSOVHGSA-N |
| XLogP | 3.39 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|