C12H11F5N6 — CID 163493221
3-(5-methyl-1H-1,2,4-triazole-3-carboximidoyl)-N-(2,2,3,3,3-pentafluoropropyl)pyridin-2-amine (PubChem CID 163493221) has the molecular formula C12H11F5N6 and a molecular weight of 334.25 g/mol. Its IUPAC name is 3-(5-methyl-1H-1,2,4-triazole-3-carboximidoyl)-N-(2,2,3,3,3-pentafluoropropyl)pyridin-2-amine.
| Compound Name | 3-(5-methyl-1H-1,2,4-triazole-3-carboximidoyl)-N-(2,2,3,3,3-pentafluoropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 163493221 |
| Molecular Formula | C12H11F5N6 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 3-(5-methyl-1H-1,2,4-triazole-3-carboximidoyl)-N-(2,2,3,3,3-pentafluoropropyl)pyridin-2-amine |
| SMILES | [H]/N=C(\c1n[nH]c(C)n1)c1cccnc1NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F5N6/c1-6-21-10(23-22-6)8(18)7-3-2-4-19-9(7)20-5-11(13,14)12(15,16)17/h2-4,18H,5H2,1H3,(H,19,20)(H,21,22,23)/b18-8- |
| InChIKey | COJZOELRVCBQPE-LSCVHKIXSA-N |
| XLogP | 2.53 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|