C42H31N3O2 — CID 167132248
2-[3-[(2-aminophenoxy)methyl]-5-(1,3-benzoxazol-2-yl)phenyl]-4-(9,9-dimethylfluoren-2-yl)benzonitrile (PubChem CID 167132248) has the molecular formula C42H31N3O2 and a molecular weight of 609.73 g/mol. Its IUPAC name is 2-[3-[(2-aminophenoxy)methyl]-5-(1,3-benzoxazol-2-yl)phenyl]-4-(9,9-dimethylfluoren-2-yl)benzonitrile.
| Compound Name | 2-[3-[(2-aminophenoxy)methyl]-5-(1,3-benzoxazol-2-yl)phenyl]-4-(9,9-dimethylfluoren-2-yl)benzonitrile |
|---|---|
| PubChem CID | 167132248 |
| Molecular Formula | C42H31N3O2 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 2-[3-[(2-aminophenoxy)methyl]-5-(1,3-benzoxazol-2-yl)phenyl]-4-(9,9-dimethylfluoren-2-yl)benzonitrile |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(C#N)c(-c4cc(COc5ccccc5N)cc(-c5nc6ccccc6o5)c4)c3)cc21 |
| InChI | InChI=1S/C42H31N3O2/c1-42(2)35-10-4-3-9-32(35)33-18-17-28(23-36(33)42)27-15-16-29(24-43)34(22-27)30-19-26(25-46-39-13-7-5-11-37(39)44)20-31(21-30)41-45-38-12-6-8-14-40(38)47-41/h3-23H,25,44H2,1-2H3 |
| InChIKey | BWZQGHDLXCLLHB-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|