C13H12F2N6O — CID 167133487
2-(3,5-difluoro-4-pyridinyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 167133487) has the molecular formula C13H12F2N6O and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-pyridinyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(3,5-difluoro-4-pyridinyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 167133487 |
| Molecular Formula | C13H12F2N6O |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(3,5-difluoro-4-pyridinyl)-4-(2-ethylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CCNNc1nc(-c2c(F)cncc2F)nc2c1C(=O)NC2 |
| InChI | InChI=1S/C13H12F2N6O/c1-2-18-21-12-10-8(5-17-13(10)22)19-11(20-12)9-6(14)3-16-4-7(9)15/h3-4,18H,2,5H2,1H3,(H,17,22)(H,19,20,21) |
| InChIKey | DIZAZVBXPMDDGC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|