C18H26F2 — CID 167138334
1-[2-(1,1-difluoroethyl)oct-7-enyl]-4-ethylbenzene (PubChem CID 167138334) has the molecular formula C18H26F2 and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-[2-(1,1-difluoroethyl)oct-7-enyl]-4-ethylbenzene.
| Compound Name | 1-[2-(1,1-difluoroethyl)oct-7-enyl]-4-ethylbenzene |
|---|---|
| PubChem CID | 167138334 |
| Molecular Formula | C18H26F2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[2-(1,1-difluoroethyl)oct-7-enyl]-4-ethylbenzene |
| SMILES | C=CCCCCC(Cc1ccc(CC)cc1)C(C)(F)F |
| InChI | InChI=1S/C18H26F2/c1-4-6-7-8-9-17(18(3,19)20)14-16-12-10-15(5-2)11-13-16/h4,10-13,17H,1,5-9,14H2,2-3H3 |
| InChIKey | QYDMCSTVGJIIIV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|