C21H26BrN5O3S — CID 167141818
tert-butyl 14-bromo-9,12-dimethyl-7-thiomorpholin-4-yl-10-oxa-2,4,6,13-tetrazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate (PubChem CID 167141818) has the molecular formula C21H26BrN5O3S and a molecular weight of 508.44 g/mol. Its IUPAC name is tert-butyl 14-bromo-9,12-dimethyl-7-thiomorpholin-4-yl-10-oxa-2,4,6,13-tetrazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate.
| Compound Name | tert-butyl 14-bromo-9,12-dimethyl-7-thiomorpholin-4-yl-10-oxa-2,4,6,13-tetrazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate |
|---|---|
| PubChem CID | 167141818 |
| Molecular Formula | C21H26BrN5O3S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | tert-butyl 14-bromo-9,12-dimethyl-7-thiomorpholin-4-yl-10-oxa-2,4,6,13-tetrazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxylate |
| SMILES | Cc1nc(Br)cc2c1OC(C)c1c(N3CCSCC3)ncnc1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26BrN5O3S/c1-12-17-14(10-15(22)25-12)27(20(28)30-21(3,4)5)19-16(13(2)29-17)18(23-11-24-19)26-6-8-31-9-7-26/h10-11,13H,6-9H2,1-5H3 |
| InChIKey | IZXSCNWUMQTEEH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|