C28H39BN4O7S — CID 164545837
tert-butyl (5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimido[5,4-c][1,5]benzoxazepine-11-carboxylate (PubChem CID 164545837) has the molecular formula C28H39BN4O7S and a molecular weight of 586.52 g/mol. Its IUPAC name is tert-butyl (5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimido[5,4-c][1,5]benzoxazepine-11-carboxylate.
| Compound Name | tert-butyl (5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimido[5,4-c][1,5]benzoxazepine-11-carboxylate |
|---|---|
| PubChem CID | 164545837 |
| Molecular Formula | C28H39BN4O7S |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | tert-butyl (5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrimido[5,4-c][1,5]benzoxazepine-11-carboxylate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc2c1O[C@H](C)c1c(N3CCS(=O)(=O)CC3)ncnc1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H39BN4O7S/c1-17-14-19(29-39-27(6,7)28(8,9)40-29)15-20-22(17)37-18(2)21-23(32-10-12-41(35,36)13-11-32)30-16-31-24(21)33(20)25(34)38-26(3,4)5/h14-16,18H,10-13H2,1-9H3/t18-/m1/s1 |
| InChIKey | ULCZXZHYUVBNIB-GOSISDBHSA-N |
| XLogP | 3.85 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|