C30H42N6O5S — CID 171408490
tert-butyl (3R)-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-7-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 171408490) has the molecular formula C30H42N6O5S and a molecular weight of 598.77 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-7-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-7-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171408490 |
| Molecular Formula | C30H42N6O5S |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | tert-butyl (3R)-3-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-7-methyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(C2CCN([C@@H]3CCN(C(=O)OC(C)(C)C)C3)CC2)cc2c1OCc1c(ncnc1N1CCS(=O)(=O)CC1)N2 |
| InChI | InChI=1S/C30H42N6O5S/c1-20-15-22(21-5-8-34(9-6-21)23-7-10-36(17-23)29(37)41-30(2,3)4)16-25-26(20)40-18-24-27(33-25)31-19-32-28(24)35-11-13-42(38,39)14-12-35/h15-16,19,21,23H,5-14,17-18H2,1-4H3,(H,31,32,33)/t23-/m1/s1 |
| InChIKey | FGNOYLXPTGUYOR-HSZRJFAPSA-N |
| XLogP | 3.84 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |