C20H24ClN5O3S — CID 164545410
4-(7-chloro-9-piperidin-4-yl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 164545410) has the molecular formula C20H24ClN5O3S and a molecular weight of 449.96 g/mol. Its IUPAC name is 4-(7-chloro-9-piperidin-4-yl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(7-chloro-9-piperidin-4-yl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 164545410 |
| Molecular Formula | C20H24ClN5O3S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 4-(7-chloro-9-piperidin-4-yl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(c2ncnc3c2COc2c(Cl)cc(C4CCNCC4)cc2N3)CC1 |
| InChI | InChI=1S/C20H24ClN5O3S/c21-16-9-14(13-1-3-22-4-2-13)10-17-18(16)29-11-15-19(25-17)23-12-24-20(15)26-5-7-30(27,28)8-6-26/h9-10,12-13,22H,1-8,11H2,(H,23,24,25) |
| InChIKey | TZUQUUOJGCDPNN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |