C26H34N6O3S — CID 171408594
4-[(5R)-7-cyclopropyl-5-methyl-9-[1-[(3S)-pyrrolidin-3-yl]azetidin-3-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 171408594) has the molecular formula C26H34N6O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is 4-[(5R)-7-cyclopropyl-5-methyl-9-[1-[(3S)-pyrrolidin-3-yl]azetidin-3-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(5R)-7-cyclopropyl-5-methyl-9-[1-[(3S)-pyrrolidin-3-yl]azetidin-3-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 171408594 |
| Molecular Formula | C26H34N6O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 4-[(5R)-7-cyclopropyl-5-methyl-9-[1-[(3S)-pyrrolidin-3-yl]azetidin-3-yl]-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | C[C@H]1Oc2c(cc(C3CN([C@H]4CCNC4)C3)cc2C2CC2)Nc2ncnc(N3CCS(=O)(=O)CC3)c21 |
| InChI | InChI=1S/C26H34N6O3S/c1-16-23-25(28-15-29-26(23)31-6-8-36(33,34)9-7-31)30-22-11-18(10-21(17-2-3-17)24(22)35-16)19-13-32(14-19)20-4-5-27-12-20/h10-11,15-17,19-20,27H,2-9,12-14H2,1H3,(H,28,29,30)/t16-,20+/m1/s1 |
| InChIKey | LGQOIJOKPBLOKN-UZLBHIALSA-N |
| XLogP | 2.55 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |