C18H22N4O3S — CID 167141547
4-[(5R)-5,7,9-trimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 167141547) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 4-[(5R)-5,7,9-trimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(5R)-5,7,9-trimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 167141547 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[(5R)-5,7,9-trimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | Cc1cc(C)c2c(c1)Nc1ncnc(N3CCS(=O)(=O)CC3)c1[C@@H](C)O2 |
| InChI | InChI=1S/C18H22N4O3S/c1-11-8-12(2)16-14(9-11)21-17-15(13(3)25-16)18(20-10-19-17)22-4-6-26(23,24)7-5-22/h8-10,13H,4-7H2,1-3H3,(H,19,20,21)/t13-/m1/s1 |
| InChIKey | HOGZRXXNBYPEQU-CYBMUJFWSA-N |
| XLogP | 2.53 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |