C21H25N5O3S — CID 164545297
4-[9-(azetidin-3-yl)-7-cyclopropyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 164545297) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-[9-(azetidin-3-yl)-7-cyclopropyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[9-(azetidin-3-yl)-7-cyclopropyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 164545297 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-[9-(azetidin-3-yl)-7-cyclopropyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-4-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(c2ncnc3c2COc2c(cc(C4CNC4)cc2C2CC2)N3)CC1 |
| InChI | InChI=1S/C21H25N5O3S/c27-30(28)5-3-26(4-6-30)21-17-11-29-19-16(13-1-2-13)7-14(15-9-22-10-15)8-18(19)25-20(17)23-12-24-21/h7-8,12-13,15,22H,1-6,9-11H2,(H,23,24,25) |
| InChIKey | URNNNUCMGOSRLO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |