About 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine
2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine (PubChem CID 167142299) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine.
Analyze 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine?
The IUPAC name of 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine (CID 167142299) is 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine.
What is the SMILES notation for 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine?
The canonical SMILES for 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine is CC1=C(C)OCCC(C)N1.
What is the InChIKey of 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine?
The InChIKey is KDKUPGHLTXCLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-6-4-5-10-8(3)7(2)9-6/h6,9H,4-5H2,1-3H3.
What are the key properties of 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine?
2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine has a molecular weight of 141.21 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethyl-4,5,6,7-tetrahydro-1,4-oxazepine is sourced from PubChem (CID 167142299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).