C21H27N5O2P2S — CID 167148191
3-amino-N-[2-[2,5-bis(phosphanyl)-4-piperazin-1-ylphenyl]ethyl]-6-methoxythieno[2,3-b]pyridine-2-carboxamide (PubChem CID 167148191) has the molecular formula C21H27N5O2P2S and a molecular weight of 475.50 g/mol. Its IUPAC name is 3-amino-N-[2-[2,5-bis(phosphanyl)-4-piperazin-1-ylphenyl]ethyl]-6-methoxythieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[2-[2,5-bis(phosphanyl)-4-piperazin-1-ylphenyl]ethyl]-6-methoxythieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167148191 |
| Molecular Formula | C21H27N5O2P2S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-amino-N-[2-[2,5-bis(phosphanyl)-4-piperazin-1-ylphenyl]ethyl]-6-methoxythieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccc2c(N)c(C(=O)NCCc3cc(P)c(N4CCNCC4)cc3P)sc2n1 |
| InChI | InChI=1S/C21H27N5O2P2S/c1-28-17-3-2-13-18(22)19(31-21(13)25-17)20(27)24-5-4-12-10-16(30)14(11-15(12)29)26-8-6-23-7-9-26/h2-3,10-11,23H,4-9,22,29-30H2,1H3,(H,24,27) |
| InChIKey | ZAIPSXWINIRVPT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|