C21H32O4 — CID 167148733
1,7-bis(2-ethenoxyethoxy)heptan-3-ylbenzene (PubChem CID 167148733) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 1,7-bis(2-ethenoxyethoxy)heptan-3-ylbenzene.
| Compound Name | 1,7-bis(2-ethenoxyethoxy)heptan-3-ylbenzene |
|---|---|
| PubChem CID | 167148733 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1,7-bis(2-ethenoxyethoxy)heptan-3-ylbenzene |
| SMILES | C=COCCOCCCCC(CCOCCOC=C)c1ccccc1 |
| InChI | InChI=1S/C21H32O4/c1-3-22-16-18-24-14-9-8-12-21(20-10-6-5-7-11-20)13-15-25-19-17-23-4-2/h3-7,10-11,21H,1-2,8-9,12-19H2 |
| InChIKey | DZADESHIMOBPFQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|