C20H30O4 — CID 91160938
1,6-bis(2-ethenoxyethoxy)hexan-3-ylbenzene (PubChem CID 91160938) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1,6-bis(2-ethenoxyethoxy)hexan-3-ylbenzene.
| Compound Name | 1,6-bis(2-ethenoxyethoxy)hexan-3-ylbenzene |
|---|---|
| PubChem CID | 91160938 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1,6-bis(2-ethenoxyethoxy)hexan-3-ylbenzene |
| SMILES | C=COCCOCCCC(CCOCCOC=C)c1ccccc1 |
| InChI | InChI=1S/C20H30O4/c1-3-21-15-17-23-13-8-11-20(19-9-6-5-7-10-19)12-14-24-18-16-22-4-2/h3-7,9-10,20H,1-2,8,11-18H2 |
| InChIKey | LSRGKSNLNMPSHQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|