C20H25ClN2O3 — CID 167156948
tert-butyl N-[6-[2-(4-chlorophenyl)-1-hydroxy-2-methylpropyl]-3-pyridinyl]carbamate (PubChem CID 167156948) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is tert-butyl N-[6-[2-(4-chlorophenyl)-1-hydroxy-2-methylpropyl]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[2-(4-chlorophenyl)-1-hydroxy-2-methylpropyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 167156948 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | tert-butyl N-[6-[2-(4-chlorophenyl)-1-hydroxy-2-methylpropyl]-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(O)C(C)(C)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-19(2,3)26-18(25)23-15-10-11-16(22-12-15)17(24)20(4,5)13-6-8-14(21)9-7-13/h6-12,17,24H,1-5H3,(H,23,25) |
| InChIKey | CWPYONVEMKDZIA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |