C36H43NO14 — CID 167159774
[2-acetyloxy-5-[[6-[[5,12-dihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]pentan-2-yl] acetate (PubChem CID 167159774) has the molecular formula C36H43NO14 and a molecular weight of 713.73 g/mol. Its IUPAC name is [2-acetyloxy-5-[[6-[[5,12-dihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]pentan-2-yl] acetate.
| Compound Name | [2-acetyloxy-5-[[6-[[5,12-dihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]pentan-2-yl] acetate |
|---|---|
| PubChem CID | 167159774 |
| Molecular Formula | C36H43NO14 |
| Molecular Weight | 713.73 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | [2-acetyloxy-5-[[6-[[5,12-dihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]pentan-2-yl] acetate |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(C(=O)CO)CC3OC1CC(NCCCC(C)(OC(C)=O)OC(C)=O)C(O)C(C)O1 |
| InChI | InChI=1S/C36H43NO14/c1-16-31(42)22(37-11-7-10-36(4,50-17(2)39)51-18(3)40)14-26(48-16)49-25-13-19(23(41)15-38)12-21-28(25)35(46)30-29(33(21)44)32(43)20-8-6-9-24(47-5)27(20)34(30)45/h6,8-9,16,19,22,25-26,31,37-38,42,44,46H,7,10-15H2,1-5H3 |
| InChIKey | ROGMVSFGQHYMGN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 224.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.73 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|