C31H20F5O2Sb — CID 16716725
(tetraphenyl-λ5-stibanyl) 2,3,4,5,6-pentafluorobenzoate (PubChem CID 16716725) has the molecular formula C31H20F5O2Sb and a molecular weight of 641.25 g/mol. Its IUPAC name is (tetraphenyl-λ5-stibanyl) 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | (tetraphenyl-λ5-stibanyl) 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 16716725 |
| Molecular Formula | C31H20F5O2Sb |
| Molecular Weight | 641.25 g/mol |
| Exact Mass | 640.04 |
| IUPAC Name | (tetraphenyl-λ5-stibanyl) 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(O[Sb](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7HF5O2.4C6H5.Sb/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;4*1-2-4-6-5-3-1;/h(H,13,14);4*1-5H;/q;;;;;+1/p-1 |
| InChIKey | PVIRSVXXZARQDC-UHFFFAOYSA-M |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|