C35H30F3O2Sb — CID 16716727
[tetrakis(4-methylphenyl)-lambda5-stibanyl] 3,4,5-trifluorobenzoate (PubChem CID 16716727) has the molecular formula C35H30F3O2Sb and a molecular weight of 661.38 g/mol. Its IUPAC name is [tetrakis(4-methylphenyl)-lambda5-stibanyl] 3,4,5-trifluorobenzoate.
| Compound Name | [tetrakis(4-methylphenyl)-lambda5-stibanyl] 3,4,5-trifluorobenzoate |
|---|---|
| PubChem CID | 16716727 |
| Molecular Formula | C35H30F3O2Sb |
| Molecular Weight | 661.38 g/mol |
| Exact Mass | 660.12 |
| IUPAC Name | [tetrakis(4-methylphenyl)-lambda5-stibanyl] 3,4,5-trifluorobenzoate |
| SMILES | Cc1ccc([Sb](OC(=O)c2cc(F)c(F)c(F)c2)(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C7H3F3O2.4C7H7.Sb/c8-4-1-3(7(11)12)2-5(9)6(4)10;4*1-7-5-3-2-4-6-7;/h1-2H,(H,11,12);4*3-6H,1H3;/q;;;;;+1/p-1 |
| InChIKey | WPGGDSFWXLLQMN-UHFFFAOYSA-M |
| XLogP | 6.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|