C16H17N5O4S — CID 167168861
5-acetyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole (PubChem CID 167168861) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 5-acetyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole.
| Compound Name | 5-acetyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 167168861 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 5-acetyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole |
| SMILES | CC(=O)c1cnc(-c2cnc3[nH]ccc3c2NC2CC(NS(=O)O)C2)o1 |
| InChI | InChI=1S/C16H17N5O4S/c1-8(22)13-7-19-16(25-13)12-6-18-15-11(2-3-17-15)14(12)20-9-4-10(5-9)21-26(23)24/h2-3,6-7,9-10,21H,4-5H2,1H3,(H,23,24)(H2,17,18,20) |
| InChIKey | MWTPWEBGNRTVAU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|