C15H17N5O2S2 — CID 167168874
4-methyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-thiazole (PubChem CID 167168874) has the molecular formula C15H17N5O2S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is 4-methyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 167168874 |
| Molecular Formula | C15H17N5O2S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-methyl-2-[4-[[3-(sulfinoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-thiazole |
| SMILES | Cc1csc(-c2cnc3[nH]ccc3c2NC2CC(NS(=O)O)C2)n1 |
| InChI | InChI=1S/C15H17N5O2S2/c1-8-7-23-15(18-8)12-6-17-14-11(2-3-16-14)13(12)19-9-4-10(5-9)20-24(21)22/h2-3,6-7,9-10,20H,4-5H2,1H3,(H,21,22)(H2,16,17,19) |
| InChIKey | NNYMWLFWKNTJRF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|