C13H7FN4S — CID 139365305
4-(2-fluoro-4-pyridinyl)-3-thia-5,7,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (PubChem CID 139365305) has the molecular formula C13H7FN4S and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-(2-fluoro-4-pyridinyl)-3-thia-5,7,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene.
| Compound Name | 4-(2-fluoro-4-pyridinyl)-3-thia-5,7,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
|---|---|
| PubChem CID | 139365305 |
| Molecular Formula | C13H7FN4S |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 4-(2-fluoro-4-pyridinyl)-3-thia-5,7,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| SMILES | Fc1cc(-c2nc3[nH]c4ccncc4c3s2)ccn1 |
| InChI | InChI=1S/C13H7FN4S/c14-10-5-7(1-4-16-10)13-18-12-11(19-13)8-6-15-3-2-9(8)17-12/h1-6,17H |
| InChIKey | FZEZSALLNCVUHE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|