C10H8N4S — CID 657967
11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 657967) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is 11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 657967 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Cc1ccc2c(n1)sc1c(N)ncnc12 |
| InChI | InChI=1S/C10H8N4S/c1-5-2-3-6-7-8(15-10(6)14-5)9(11)13-4-12-7/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | FBXWDYDNTNRGBD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |