C16H25NO4 — CID 167169052
tert-butyl 2-[(1R,2S,6R)-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetate (PubChem CID 167169052) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2S,6R)-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetate.
| Compound Name | tert-butyl 2-[(1R,2S,6R)-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetate |
|---|---|
| PubChem CID | 167169052 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl 2-[(1R,2S,6R)-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@]1(C[N+](=O)[O-])C2CC[C@@H]3CC2[C@H]1C3 |
| InChI | InChI=1S/C16H25NO4/c1-15(2,3)21-14(18)8-16(9-17(19)20)12-5-4-10-6-11(12)13(16)7-10/h10-13H,4-9H2,1-3H3/t10-,11?,12?,13-,16+/m1/s1 |
| InChIKey | MFDLHSJFRYFDJO-VEQOONCESA-N |
| XLogP | 3.05 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|