C23H24F2N4O4S — CID 167169920
[(9R)-3-(difluoromethyl)-9-methyl-8-oxo-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl] 4-methylbenzenesulfonate (PubChem CID 167169920) has the molecular formula C23H24F2N4O4S and a molecular weight of 490.53 g/mol. Its IUPAC name is [(9R)-3-(difluoromethyl)-9-methyl-8-oxo-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl] 4-methylbenzenesulfonate.
| Compound Name | [(9R)-3-(difluoromethyl)-9-methyl-8-oxo-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167169920 |
| Molecular Formula | C23H24F2N4O4S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [(9R)-3-(difluoromethyl)-9-methyl-8-oxo-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-13-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC[C@@H](C)C(=O)Nc3cnn(C(F)F)c3-c3ccnc2c3)cc1 |
| InChI | InChI=1S/C23H24F2N4O4S/c1-14-6-8-17(9-7-14)34(31,32)33-20-5-3-4-15(2)22(30)28-19-13-27-29(23(24)25)21(19)16-10-11-26-18(20)12-16/h6-13,15,20,23H,3-5H2,1-2H3,(H,28,30)/t15-,20?/m1/s1 |
| InChIKey | QULKADNOWYHUOB-IWPPFLRJSA-N |
| XLogP | 4.85 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|