C24H16O10 — CID 167171531
4-[5-(hydroxymethyl)-1,3-dioxo-2-benzofuran-4-carbonyl]oxy-2-(2-hydroxy-4-methylphenoxy)benzoic acid (PubChem CID 167171531) has the molecular formula C24H16O10 and a molecular weight of 464.38 g/mol. Its IUPAC name is 4-[5-(hydroxymethyl)-1,3-dioxo-2-benzofuran-4-carbonyl]oxy-2-(2-hydroxy-4-methylphenoxy)benzoic acid.
| Compound Name | 4-[5-(hydroxymethyl)-1,3-dioxo-2-benzofuran-4-carbonyl]oxy-2-(2-hydroxy-4-methylphenoxy)benzoic acid |
|---|---|
| PubChem CID | 167171531 |
| Molecular Formula | C24H16O10 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-[5-(hydroxymethyl)-1,3-dioxo-2-benzofuran-4-carbonyl]oxy-2-(2-hydroxy-4-methylphenoxy)benzoic acid |
| SMILES | Cc1ccc(Oc2cc(OC(=O)c3c(CO)ccc4c3C(=O)OC4=O)ccc2C(=O)O)c(O)c1 |
| InChI | InChI=1S/C24H16O10/c1-11-2-7-17(16(26)8-11)33-18-9-13(4-6-14(18)21(27)28)32-23(30)19-12(10-25)3-5-15-20(19)24(31)34-22(15)29/h2-9,25-26H,10H2,1H3,(H,27,28) |
| InChIKey | MQUKASBZJCZSRY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|