C26H40N2O4S4 — CID 167188839
2-(propyldisulfanyl)ethyl 3-[2-(1H-indol-3-yl)ethyl-[3-oxo-3-[2-(propyldisulfanyl)ethoxy]propyl]amino]propanoate (PubChem CID 167188839) has the molecular formula C26H40N2O4S4 and a molecular weight of 572.88 g/mol. Its IUPAC name is 2-(propyldisulfanyl)ethyl 3-[2-(1H-indol-3-yl)ethyl-[3-oxo-3-[2-(propyldisulfanyl)ethoxy]propyl]amino]propanoate.
| Compound Name | 2-(propyldisulfanyl)ethyl 3-[2-(1H-indol-3-yl)ethyl-[3-oxo-3-[2-(propyldisulfanyl)ethoxy]propyl]amino]propanoate |
|---|---|
| PubChem CID | 167188839 |
| Molecular Formula | C26H40N2O4S4 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 2-(propyldisulfanyl)ethyl 3-[2-(1H-indol-3-yl)ethyl-[3-oxo-3-[2-(propyldisulfanyl)ethoxy]propyl]amino]propanoate |
| SMILES | CCCSSCCOC(=O)CCN(CCC(=O)OCCSSCCC)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H40N2O4S4/c1-3-17-33-35-19-15-31-25(29)10-13-28(14-11-26(30)32-16-20-36-34-18-4-2)12-9-22-21-27-24-8-6-5-7-23(22)24/h5-8,21,27H,3-4,9-20H2,1-2H3 |
| InChIKey | BKOKMUKMQMCZSH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|