C39H38Cl2N4O4 — CID 167189043
4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(2-chlorophenyl)-1-[(4-cyanophenyl)methyl]-5'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid (PubChem CID 167189043) has the molecular formula C39H38Cl2N4O4 and a molecular weight of 697.66 g/mol. Its IUPAC name is 4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(2-chlorophenyl)-1-[(4-cyanophenyl)methyl]-5'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(2-chlorophenyl)-1-[(4-cyanophenyl)methyl]-5'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167189043 |
| Molecular Formula | C39H38Cl2N4O4 |
| Molecular Weight | 697.66 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | 4-[[(2'R,3S,3'S,5'S)-5-chloro-3'-(2-chlorophenyl)-1-[(4-cyanophenyl)methyl]-5'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@@]2(CN(Cc3ccc(C#N)cc3)c3ccc(Cl)cc32)[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C39H38Cl2N4O4/c1-38(2,3)19-33-39(22-45(31-16-14-26(40)18-28(31)39)21-24-11-9-23(20-42)10-12-24)34(27-7-5-6-8-29(27)41)35(44-33)36(46)43-30-15-13-25(37(47)48)17-32(30)49-4/h5-18,33-35,44H,19,21-22H2,1-4H3,(H,43,46)(H,47,48)/t33-,34-,35+,39-/m0/s1 |
| InChIKey | ZHLIDDCSJIMKAA-OTGBHNIOSA-N |
| XLogP | 8.03 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.66 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |