C21H25FN4O2 — CID 167189107
7-(1-fluoropropylamino)-3-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-1-methyl-1,6-naphthyridin-2-one (PubChem CID 167189107) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 7-(1-fluoropropylamino)-3-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-1-methyl-1,6-naphthyridin-2-one.
| Compound Name | 7-(1-fluoropropylamino)-3-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-1-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 167189107 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 7-(1-fluoropropylamino)-3-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-1-methyl-1,6-naphthyridin-2-one |
| SMILES | CCC(F)Nc1cc2c(cn1)cc(-c1cnc(C(O)CC)cc1C)c(=O)n2C |
| InChI | InChI=1S/C21H25FN4O2/c1-5-18(27)16-7-12(3)15(11-23-16)14-8-13-10-24-20(25-19(22)6-2)9-17(13)26(4)21(14)28/h7-11,18-19,27H,5-6H2,1-4H3,(H,24,25) |
| InChIKey | OFQJRWUTJLTZFU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|