C24H24F2N6O2 — CID 174205511
(1R)-N-[2-ethyl-4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide (PubChem CID 174205511) has the molecular formula C24H24F2N6O2 and a molecular weight of 466.49 g/mol. Its IUPAC name is (1R)-N-[2-ethyl-4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[2-ethyl-4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 174205511 |
| Molecular Formula | C24H24F2N6O2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (1R)-N-[2-ethyl-4-[6-[(1R)-1-hydroxypropyl]-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide |
| SMILES | CCc1nc2c(-c3cnc([C@H](O)CC)cc3C)cc3cnc(NC(=O)[C@H]4CC4(F)F)cc3n2n1 |
| InChI | InChI=1S/C24H24F2N6O2/c1-4-19(33)17-6-12(3)15(11-27-17)14-7-13-10-28-21(30-23(34)16-9-24(16,25)26)8-18(13)32-22(14)29-20(5-2)31-32/h6-8,10-11,16,19,33H,4-5,9H2,1-3H3,(H,28,30,34)/t16-,19-/m1/s1 |
| InChIKey | GGVQSGUDBVXBEU-VQIMIIECSA-N |
| XLogP | 4.25 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |