C25H24F2N6O2 — CID 170968190
(1R)-N-[2-cyclopropyl-4-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide (PubChem CID 170968190) has the molecular formula C25H24F2N6O2 and a molecular weight of 478.50 g/mol. Its IUPAC name is (1R)-N-[2-cyclopropyl-4-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[2-cyclopropyl-4-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170968190 |
| Molecular Formula | C25H24F2N6O2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (1R)-N-[2-cyclopropyl-4-[6-(1-hydroxypropyl)-4-methyl-3-pyridinyl]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]-2,2-difluorocyclopropane-1-carboxamide |
| SMILES | CCC(O)c1cc(C)c(-c2cc3cnc(NC(=O)[C@H]4CC4(F)F)cc3n3nc(C4CC4)nc23)cn1 |
| InChI | InChI=1S/C25H24F2N6O2/c1-3-20(34)18-6-12(2)16(11-28-18)15-7-14-10-29-21(30-24(35)17-9-25(17,26)27)8-19(14)33-23(15)31-22(32-33)13-4-5-13/h6-8,10-11,13,17,20,34H,3-5,9H2,1-2H3,(H,29,30,35)/t17-,20?/m1/s1 |
| InChIKey | PHXPQJRVPVNFHL-DIAVIDTQSA-N |
| XLogP | 4.56 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |