C24H35NO9 — CID 167192304
3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl 2-[(2-ethoxyphenoxy)methyl]oxane-4-carboxylate (PubChem CID 167192304) has the molecular formula C24H35NO9 and a molecular weight of 481.54 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl 2-[(2-ethoxyphenoxy)methyl]oxane-4-carboxylate.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl 2-[(2-ethoxyphenoxy)methyl]oxane-4-carboxylate |
|---|---|
| PubChem CID | 167192304 |
| Molecular Formula | C24H35NO9 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl 2-[(2-ethoxyphenoxy)methyl]oxane-4-carboxylate |
| SMILES | CCOc1ccccc1OCC1CC(C(=O)OCOC(=O)CCNC(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C24H35NO9/c1-5-29-19-8-6-7-9-20(19)31-15-18-14-17(11-13-30-18)22(27)33-16-32-21(26)10-12-25-23(28)34-24(2,3)4/h6-9,17-18H,5,10-16H2,1-4H3,(H,25,28) |
| InChIKey | YNPGGYSASZKPJN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|