C21H24F4N2O — CID 167194589
4-(2-fluorophenoxy)-2-(3-propan-2-ylpiperidin-1-yl)-3-(trifluoromethyl)aniline (PubChem CID 167194589) has the molecular formula C21H24F4N2O and a molecular weight of 396.43 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-2-(3-propan-2-ylpiperidin-1-yl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-(2-fluorophenoxy)-2-(3-propan-2-ylpiperidin-1-yl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 167194589 |
| Molecular Formula | C21H24F4N2O |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-(2-fluorophenoxy)-2-(3-propan-2-ylpiperidin-1-yl)-3-(trifluoromethyl)aniline |
| SMILES | CC(C)C1CCCN(c2c(N)ccc(Oc3ccccc3F)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C21H24F4N2O/c1-13(2)14-6-5-11-27(12-14)20-16(26)9-10-18(19(20)21(23,24)25)28-17-8-4-3-7-15(17)22/h3-4,7-10,13-14H,5-6,11-12,26H2,1-2H3 |
| InChIKey | UKFKRXLYBHGKSU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|