C17H14F5N3O3S — CID 167196711
6-(3-ethylsulfanyl-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 167196711) has the molecular formula C17H14F5N3O3S and a molecular weight of 435.37 g/mol. Its IUPAC name is 6-(3-ethylsulfanyl-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | 6-(3-ethylsulfanyl-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 167196711 |
| Molecular Formula | C17H14F5N3O3S |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 6-(3-ethylsulfanyl-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | CCSc1ccc[n+]([O-])c1-c1cc2c(cn1)N(CC(F)(F)C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C17H14F5N3O3S/c1-2-29-13-4-3-5-25(27)14(13)11-6-10-8-28-15(26)24(12(10)7-23-11)9-16(18,19)17(20,21)22/h3-7H,2,8-9H2,1H3 |
| InChIKey | TXXVKHONCMNOFO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|