C21H17F5N4O4S — CID 164588966
1-[5-ethylsulfonyl-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile (PubChem CID 164588966) has the molecular formula C21H17F5N4O4S and a molecular weight of 516.45 g/mol. Its IUPAC name is 1-[5-ethylsulfonyl-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[5-ethylsulfonyl-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 164588966 |
| Molecular Formula | C21H17F5N4O4S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 1-[5-ethylsulfonyl-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile |
| SMILES | CCS(=O)(=O)c1cc(C2(C#N)CC2)cnc1-c1cc2c(cn1)N(CC(F)(F)C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C21H17F5N4O4S/c1-2-35(32,33)16-6-13(19(10-27)3-4-19)7-29-17(16)14-5-12-9-34-18(31)30(15(12)8-28-14)11-20(22,23)21(24,25)26/h5-8H,2-4,9,11H2,1H3 |
| InChIKey | WAMXHSIGTVQRBS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 113.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|