C20H18F5N3O4S — CID 164588995
6-(6-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 164588995) has the molecular formula C20H18F5N3O4S and a molecular weight of 491.44 g/mol. Its IUPAC name is 6-(6-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | 6-(6-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 164588995 |
| Molecular Formula | C20H18F5N3O4S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 6-(6-cyclopropyl-3-ethylsulfonyl-2-pyridinyl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | CCS(=O)(=O)c1ccc(C2CC2)nc1-c1cc2c(cn1)N(CC(F)(F)C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C20H18F5N3O4S/c1-2-33(30,31)16-6-5-13(11-3-4-11)27-17(16)14-7-12-9-32-18(29)28(15(12)8-26-14)10-19(21,22)20(23,24)25/h5-8,11H,2-4,9-10H2,1H3 |
| InChIKey | WYGLVRBCUZBELJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|