C17H14ClF5N3O4S+ — CID 164588992
CID 164588992 (PubChem CID 164588992) has the molecular formula C17H14ClF5N3O4S+ and a molecular weight of 486.83 g/mol.
| Compound Name | CID 164588992 |
|---|---|
| PubChem CID | 164588992 |
| Molecular Formula | C17H14ClF5N3O4S+ |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | — |
| SMILES | CC[S+](=O)(O)c1ccc(Cl)nc1-c1cc2c(cn1)N(CC(F)(F)C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C17H13ClF5N3O4S/c1-2-31(28,29)12-3-4-13(18)25-14(12)10-5-9-7-30-15(27)26(11(9)6-24-10)8-16(19,20)17(21,22)23/h3-6H,2,7-8H2,1H3/p+1 |
| InChIKey | VMLWOPTXOHFGBK-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|