C16H26N4O2S — CID 167197840
1,3-bis[2-(methylamino)ethyl]-5,5-bis(prop-2-enyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 167197840) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 1,3-bis[2-(methylamino)ethyl]-5,5-bis(prop-2-enyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-bis[2-(methylamino)ethyl]-5,5-bis(prop-2-enyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 167197840 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1,3-bis[2-(methylamino)ethyl]-5,5-bis(prop-2-enyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCC1(CC=C)C(=O)N(CCNC)C(=S)N(CCNC)C1=O |
| InChI | InChI=1S/C16H26N4O2S/c1-5-7-16(8-6-2)13(21)19(11-9-17-3)15(23)20(14(16)22)12-10-18-4/h5-6,17-18H,1-2,7-12H2,3-4H3 |
| InChIKey | JOWVZJGFPRMLAQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|