C18H20Cl2N2O4 — CID 167203391
(3S)-5,6-dichloro-1'-[(1S,3S,4S)-3,4-dihydroxycyclohexanecarbonyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 167203391) has the molecular formula C18H20Cl2N2O4 and a molecular weight of 399.27 g/mol. Its IUPAC name is (3S)-5,6-dichloro-1'-[(1S,3S,4S)-3,4-dihydroxycyclohexanecarbonyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (3S)-5,6-dichloro-1'-[(1S,3S,4S)-3,4-dihydroxycyclohexanecarbonyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 167203391 |
| Molecular Formula | C18H20Cl2N2O4 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (3S)-5,6-dichloro-1'-[(1S,3S,4S)-3,4-dihydroxycyclohexanecarbonyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C([C@H]1CC[C@H](O)[C@@H](O)C1)N1CC[C@]2(C1)C(=O)Nc1cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C18H20Cl2N2O4/c19-11-6-10-13(7-12(11)20)21-17(26)18(10)3-4-22(8-18)16(25)9-1-2-14(23)15(24)5-9/h6-7,9,14-15,23-24H,1-5,8H2,(H,21,26)/t9-,14-,15-,18+/m0/s1 |
| InChIKey | XNKBJJFHFVLOCQ-NELNZIEFSA-N |
| XLogP | 1.94 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |